C20H20ClF2NO3S — CID 90589669
3-(4-chloro-3-fluorophenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one (PubChem CID 90589669) has the molecular formula C20H20ClF2NO3S and a molecular weight of 427.90 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90589669 |
| Molecular Formula | C20H20ClF2NO3S |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-1-[4-(4-fluorophenyl)sulfonylpiperidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccc(Cl)c(F)c1)N1CCC(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H20ClF2NO3S/c21-18-7-1-14(13-19(18)23)2-8-20(25)24-11-9-17(10-12-24)28(26,27)16-5-3-15(22)4-6-16/h1,3-7,13,17H,2,8-12H2 |
| InChIKey | IENKYTJWZLGEGM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |