C18H26BrNO4S — CID 97427247
3-(3-bromo-4-methoxyphenyl)-1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]propan-1-one (PubChem CID 97427247) has the molecular formula C18H26BrNO4S and a molecular weight of 432.38 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 97427247 |
| Molecular Formula | C18H26BrNO4S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CC[C@H](S(=O)(=O)C(C)(C)C)C2)cc1Br |
| InChI | InChI=1S/C18H26BrNO4S/c1-18(2,3)25(22,23)14-9-10-20(12-14)17(21)8-6-13-5-7-16(24-4)15(19)11-13/h5,7,11,14H,6,8-10,12H2,1-4H3/t14-/m0/s1 |
| InChIKey | NIPXCJYCKMGIMN-AWEZNQCLSA-N |
| XLogP | 3.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |