C20H20Cl3NO2 — CID 25145476
1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one (PubChem CID 25145476) has the molecular formula C20H20Cl3NO2 and a molecular weight of 412.74 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one.
| Compound Name | 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 25145476 |
| Molecular Formula | C20H20Cl3NO2 |
| Molecular Weight | 412.74 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | 1-[2-(4-chlorophenyl)pyrrolidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)N1CCCC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20Cl3NO2/c21-15-7-5-14(6-8-15)18-3-1-11-24(18)20(25)4-2-12-26-19-10-9-16(22)13-17(19)23/h5-10,13,18H,1-4,11-12H2 |
| InChIKey | SFPXPZLCMGUQBI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|