C20H21ClN2O2S — CID 26993661
3-[4-(4-chlorophenyl)sulfanylbutanoylamino]-N-cyclopropylbenzamide (PubChem CID 26993661) has the molecular formula C20H21ClN2O2S and a molecular weight of 388.92 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)sulfanylbutanoylamino]-N-cyclopropylbenzamide.
| Compound Name | 3-[4-(4-chlorophenyl)sulfanylbutanoylamino]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 26993661 |
| Molecular Formula | C20H21ClN2O2S |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 3-[4-(4-chlorophenyl)sulfanylbutanoylamino]-N-cyclopropylbenzamide |
| SMILES | O=C(CCCSc1ccc(Cl)cc1)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C20H21ClN2O2S/c21-15-6-10-18(11-7-15)26-12-2-5-19(24)22-17-4-1-3-14(13-17)20(25)23-16-8-9-16/h1,3-4,6-7,10-11,13,16H,2,5,8-9,12H2,(H,22,24)(H,23,25) |
| InChIKey | WQIXQTVJULNJRS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|