C19H19ClN2O2S — CID 87026412
2-chloro-N-cyclopropyl-5-(3-phenylsulfanylpropanoylamino)benzamide (PubChem CID 87026412) has the molecular formula C19H19ClN2O2S and a molecular weight of 374.89 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-(3-phenylsulfanylpropanoylamino)benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-(3-phenylsulfanylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 87026412 |
| Molecular Formula | C19H19ClN2O2S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-(3-phenylsulfanylpropanoylamino)benzamide |
| SMILES | O=C(CCSc1ccccc1)Nc1ccc(Cl)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C19H19ClN2O2S/c20-17-9-8-14(12-16(17)19(24)22-13-6-7-13)21-18(23)10-11-25-15-4-2-1-3-5-15/h1-5,8-9,12-13H,6-7,10-11H2,(H,21,23)(H,22,24) |
| InChIKey | UPBAXOJQFLKKGR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |