C17H25ClN2O2S — CID 119662797
1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(4-chlorophenyl)sulfanylpropan-1-one (PubChem CID 119662797) has the molecular formula C17H25ClN2O2S and a molecular weight of 356.92 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(4-chlorophenyl)sulfanylpropan-1-one.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(4-chlorophenyl)sulfanylpropan-1-one |
|---|---|
| PubChem CID | 119662797 |
| Molecular Formula | C17H25ClN2O2S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-3-(4-chlorophenyl)sulfanylpropan-1-one |
| SMILES | NCCCOC1CCN(C(=O)CCSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H25ClN2O2S/c18-14-2-4-16(5-3-14)23-13-8-17(21)20-10-6-15(7-11-20)22-12-1-9-19/h2-5,15H,1,6-13,19H2 |
| InChIKey | XCKYXDHVEYLIIZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|