C18H29ClN2O3S — CID 119662845
1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride (PubChem CID 119662845) has the molecular formula C18H29ClN2O3S and a molecular weight of 388.96 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride.
| Compound Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride |
|---|---|
| PubChem CID | 119662845 |
| Molecular Formula | C18H29ClN2O3S |
| Molecular Weight | 388.96 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 1-[4-(3-aminopropoxy)piperidin-1-yl]-2-(4-ethoxyphenyl)sulfanylethanone;hydrochloride |
| SMILES | CCOc1ccc(SCC(=O)N2CCC(OCCCN)CC2)cc1.Cl |
| InChI | InChI=1S/C18H28N2O3S.ClH/c1-2-22-15-4-6-17(7-5-15)24-14-18(21)20-11-8-16(9-12-20)23-13-3-10-19;/h4-7,16H,2-3,8-14,19H2,1H3;1H |
| InChIKey | VRKRZDPAPZZMIH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.96 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|