C15H20ClNO2S — CID 115966123
3-(4-chlorophenyl)sulfanyl-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 115966123) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 115966123 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-1-[3-(1-hydroxyethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC(O)C1CCN(C(=O)CCSc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H20ClNO2S/c1-11(18)12-6-8-17(10-12)15(19)7-9-20-14-4-2-13(16)3-5-14/h2-5,11-12,18H,6-10H2,1H3 |
| InChIKey | CAZJWRAAELROHB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |