C16H23ClN2O2S — CID 75386473
N-[2-(4-chlorophenyl)sulfanylethyl]-3-(1-hydroxyethyl)piperidine-1-carboxamide (PubChem CID 75386473) has the molecular formula C16H23ClN2O2S and a molecular weight of 342.89 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-3-(1-hydroxyethyl)piperidine-1-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-(1-hydroxyethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75386473 |
| Molecular Formula | C16H23ClN2O2S |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-3-(1-hydroxyethyl)piperidine-1-carboxamide |
| SMILES | CC(O)C1CCCN(C(=O)NCCSc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H23ClN2O2S/c1-12(20)13-3-2-9-19(11-13)16(21)18-8-10-22-15-6-4-14(17)5-7-15/h4-7,12-13,20H,2-3,8-11H2,1H3,(H,18,21) |
| InChIKey | NVPWKDWLXVMFQU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|