C18H21FN4O5S2 — CID 55647465
4-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)piperidine-1-carboxamide (PubChem CID 55647465) has the molecular formula C18H21FN4O5S2 and a molecular weight of 456.52 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 55647465 |
| Molecular Formula | C18H21FN4O5S2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)piperidine-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)N2CCC(NS(=O)(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C18H21FN4O5S2/c19-13-1-5-17(6-2-13)30(27,28)22-15-9-11-23(12-10-15)18(24)21-14-3-7-16(8-4-14)29(20,25)26/h1-8,15,22H,9-12H2,(H,21,24)(H2,20,25,26) |
| InChIKey | SXBMHOYFWZYWQT-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |