C12H11F3N2O3 — CID 66980889
methyl (2R)-2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxypropanoate (PubChem CID 66980889) has the molecular formula C12H11F3N2O3 and a molecular weight of 288.23 g/mol. Its IUPAC name is methyl (2R)-2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxypropanoate.
| Compound Name | methyl (2R)-2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 66980889 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | methyl (2R)-2-[4-cyano-3-(trifluoromethyl)anilino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@@H](CO)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3N2O3/c1-20-11(19)10(6-18)17-8-3-2-7(5-16)9(4-8)12(13,14)15/h2-4,10,17-18H,6H2,1H3/t10-/m1/s1 |
| InChIKey | PPUGAXOEADSMFP-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |