C21H29F3N2O5S — CID 87719620
methylsulfonyl 2-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methylundecanoate (PubChem CID 87719620) has the molecular formula C21H29F3N2O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is methylsulfonyl 2-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methylundecanoate.
| Compound Name | methylsulfonyl 2-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methylundecanoate |
|---|---|
| PubChem CID | 87719620 |
| Molecular Formula | C21H29F3N2O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | methylsulfonyl 2-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methylundecanoate |
| SMILES | CC(C)(O)CCCCCCCC(Nc1ccc(C#N)c(C(F)(F)F)c1)C(=O)OS(C)(=O)=O |
| InChI | InChI=1S/C21H29F3N2O5S/c1-20(2,28)12-8-6-4-5-7-9-18(19(27)31-32(3,29)30)26-16-11-10-15(14-25)17(13-16)21(22,23)24/h10-11,13,18,26,28H,4-9,12H2,1-3H3 |
| InChIKey | ICMTVNYSLNZOCT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|