C21H29F3N2O5S — CID 87718882
[1-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methyl-11-oxoundecyl] methanesulfonate (PubChem CID 87718882) has the molecular formula C21H29F3N2O5S and a molecular weight of 478.53 g/mol. Its IUPAC name is [1-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methyl-11-oxoundecyl] methanesulfonate.
| Compound Name | [1-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methyl-11-oxoundecyl] methanesulfonate |
|---|---|
| PubChem CID | 87718882 |
| Molecular Formula | C21H29F3N2O5S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [1-[4-cyano-3-(trifluoromethyl)anilino]-10-hydroxy-10-methyl-11-oxoundecyl] methanesulfonate |
| SMILES | CC(O)(C=O)CCCCCCCCC(Nc1ccc(C#N)c(C(F)(F)F)c1)OS(C)(=O)=O |
| InChI | InChI=1S/C21H29F3N2O5S/c1-20(28,15-27)12-8-6-4-3-5-7-9-19(31-32(2,29)30)26-17-11-10-16(14-25)18(13-17)21(22,23)24/h10-11,13,15,19,26,28H,3-9,12H2,1-2H3 |
| InChIKey | KISZIOWNWNMIHF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|