C12H12F3N3O — CID 104843918
3-[3-cyano-4-(trifluoromethyl)anilino]butanamide (PubChem CID 104843918) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 3-[3-cyano-4-(trifluoromethyl)anilino]butanamide.
| Compound Name | 3-[3-cyano-4-(trifluoromethyl)anilino]butanamide |
|---|---|
| PubChem CID | 104843918 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 3-[3-cyano-4-(trifluoromethyl)anilino]butanamide |
| SMILES | CC(CC(N)=O)Nc1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C12H12F3N3O/c1-7(4-11(17)19)18-9-2-3-10(12(13,14)15)8(5-9)6-16/h2-3,5,7,18H,4H2,1H3,(H2,17,19) |
| InChIKey | JGUAFKOWABTIDF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |