C14H17F3N2 — CID 103461766
5-(2,2-dimethylbutylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 103461766) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 5-(2,2-dimethylbutylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-(2,2-dimethylbutylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 103461766 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 5-(2,2-dimethylbutylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | CCC(C)(C)CNc1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C14H17F3N2/c1-4-13(2,3)9-19-11-5-6-12(14(15,16)17)10(7-11)8-18/h5-7,19H,4,9H2,1-3H3 |
| InChIKey | QKSFEWKNZXMOOH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |