C12H13F3N2OS — CID 104843765
5-(2-ethylsulfinylethylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 104843765) has the molecular formula C12H13F3N2OS and a molecular weight of 290.31 g/mol. Its IUPAC name is 5-(2-ethylsulfinylethylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-(2-ethylsulfinylethylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 104843765 |
| Molecular Formula | C12H13F3N2OS |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 5-(2-ethylsulfinylethylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | CCS(=O)CCNc1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C12H13F3N2OS/c1-2-19(18)6-5-17-10-3-4-11(12(13,14)15)9(7-10)8-16/h3-4,7,17H,2,5-6H2,1H3 |
| InChIKey | BORPKQYFFAQHEY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |