C13H12F3N3O — CID 75508610
2-[3-cyano-4-(trifluoromethyl)anilino]-N-prop-2-enylacetamide (PubChem CID 75508610) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 2-[3-cyano-4-(trifluoromethyl)anilino]-N-prop-2-enylacetamide.
| Compound Name | 2-[3-cyano-4-(trifluoromethyl)anilino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 75508610 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-[3-cyano-4-(trifluoromethyl)anilino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CNc1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C13H12F3N3O/c1-2-5-18-12(20)8-19-10-3-4-11(13(14,15)16)9(6-10)7-17/h2-4,6,19H,1,5,8H2,(H,18,20) |
| InChIKey | QTDFGMHATVLOCC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|