C14H11F3N2S — CID 62844579
4-(1-thiophen-3-ylethylamino)-2-(trifluoromethyl)benzonitrile (PubChem CID 62844579) has the molecular formula C14H11F3N2S and a molecular weight of 296.32 g/mol. Its IUPAC name is 4-(1-thiophen-3-ylethylamino)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(1-thiophen-3-ylethylamino)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 62844579 |
| Molecular Formula | C14H11F3N2S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-(1-thiophen-3-ylethylamino)-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(Nc1ccc(C#N)c(C(F)(F)F)c1)c1ccsc1 |
| InChI | InChI=1S/C14H11F3N2S/c1-9(11-4-5-20-8-11)19-12-3-2-10(7-18)13(6-12)14(15,16)17/h2-6,8-9,19H,1H3 |
| InChIKey | USACHPNHSLAAMS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |