C8H12N4O4S — CID 114461535
ethyl N-[(5-amino-2-pyridinyl)sulfamoyl]carbamate (PubChem CID 114461535) has the molecular formula C8H12N4O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is ethyl N-[(5-amino-2-pyridinyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(5-amino-2-pyridinyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461535 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | ethyl N-[(5-amino-2-pyridinyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1ccc(N)cn1 |
| InChI | InChI=1S/C8H12N4O4S/c1-2-16-8(13)12-17(14,15)11-7-4-3-6(9)5-10-7/h3-5H,2,9H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | XNTCGWHNTCLBNY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |