C8H14N4O3S — CID 114814034
2-N-(2-methoxyethylsulfamoyl)pyridine-2,5-diamine (PubChem CID 114814034) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 2-N-(2-methoxyethylsulfamoyl)pyridine-2,5-diamine.
| Compound Name | 2-N-(2-methoxyethylsulfamoyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 114814034 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-N-(2-methoxyethylsulfamoyl)pyridine-2,5-diamine |
| SMILES | COCCNS(=O)(=O)Nc1ccc(N)cn1 |
| InChI | InChI=1S/C8H14N4O3S/c1-15-5-4-11-16(13,14)12-8-3-2-7(9)6-10-8/h2-3,6,11H,4-5,9H2,1H3,(H,10,12) |
| InChIKey | VZLSZJPZIKDLSN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|