C5H11N5O3S — CID 114815885
N-(2-methoxyethylsulfamoyl)-1H-1,2,4-triazol-5-amine (PubChem CID 114815885) has the molecular formula C5H11N5O3S and a molecular weight of 221.24 g/mol. Its IUPAC name is N-(2-methoxyethylsulfamoyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N-(2-methoxyethylsulfamoyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 114815885 |
| Molecular Formula | C5H11N5O3S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | N-(2-methoxyethylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| SMILES | COCCNS(=O)(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C5H11N5O3S/c1-13-3-2-8-14(11,12)10-5-6-4-7-9-5/h4,8H,2-3H2,1H3,(H2,6,7,9,10) |
| InChIKey | KFLWOIWAUBAFEX-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|