C5H11N5O2S — CID 114810083
N-(propan-2-ylsulfamoyl)-1H-1,2,4-triazol-5-amine (PubChem CID 114810083) has the molecular formula C5H11N5O2S and a molecular weight of 205.24 g/mol. Its IUPAC name is N-(propan-2-ylsulfamoyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | N-(propan-2-ylsulfamoyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 114810083 |
| Molecular Formula | C5H11N5O2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | N-(propan-2-ylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| SMILES | CC(C)NS(=O)(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C5H11N5O2S/c1-4(2)9-13(11,12)10-5-6-3-7-8-5/h3-4,9H,1-2H3,(H2,6,7,8,10) |
| InChIKey | HLEGBOKFMOEFFU-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |