C6H13N5O3S — CID 114810299
3-ethoxy-N-(ethylsulfamoyl)-1H-1,2,4-triazol-5-amine (PubChem CID 114810299) has the molecular formula C6H13N5O3S and a molecular weight of 235.27 g/mol. Its IUPAC name is 3-ethoxy-N-(ethylsulfamoyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-ethoxy-N-(ethylsulfamoyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 114810299 |
| Molecular Formula | C6H13N5O3S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-ethoxy-N-(ethylsulfamoyl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCNS(=O)(=O)Nc1nc(OCC)n[nH]1 |
| InChI | InChI=1S/C6H13N5O3S/c1-3-7-15(12,13)11-5-8-6(10-9-5)14-4-2/h7H,3-4H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | UIMVMWAFLQZTBG-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |