C5H10N4O3S — CID 104818613
N-(3-ethoxy-1H-1,2,4-triazol-5-yl)methanesulfonamide (PubChem CID 104818613) has the molecular formula C5H10N4O3S and a molecular weight of 206.23 g/mol. Its IUPAC name is N-(3-ethoxy-1H-1,2,4-triazol-5-yl)methanesulfonamide.
| Compound Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 104818613 |
| Molecular Formula | C5H10N4O3S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)methanesulfonamide |
| SMILES | CCOc1n[nH]c(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C5H10N4O3S/c1-3-12-5-6-4(7-8-5)9-13(2,10)11/h3H2,1-2H3,(H2,6,7,8,9) |
| InChIKey | BRVBDBZRRSXJPD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |