C4H8N4O — CID 13045208
3-ethoxy-1H-1,2,4-triazol-5-amine (PubChem CID 13045208) has the molecular formula C4H8N4O and a molecular weight of 128.13 g/mol. Its IUPAC name is 3-ethoxy-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-ethoxy-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 13045208 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 3-ethoxy-1H-1,2,4-triazol-5-amine |
| SMILES | CCOc1n[nH]c(N)n1 |
| InChI | InChI=1S/C4H8N4O/c1-2-9-4-6-3(5)7-8-4/h2H2,1H3,(H3,5,6,7,8) |
| InChIKey | CGNJBRBYZRWHKV-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |