C7H16N4O — CID 169237869
ethane;3-ethoxy-N-methyl-1H-1,2,4-triazol-5-amine (PubChem CID 169237869) has the molecular formula C7H16N4O and a molecular weight of 172.23 g/mol. Its IUPAC name is ethane;3-ethoxy-N-methyl-1H-1,2,4-triazol-5-amine.
| Compound Name | ethane;3-ethoxy-N-methyl-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 169237869 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | ethane;3-ethoxy-N-methyl-1H-1,2,4-triazol-5-amine |
| SMILES | CC.CCOc1n[nH]c(NC)n1 |
| InChI | InChI=1S/C5H10N4O.C2H6/c1-3-10-5-7-4(6-2)8-9-5;1-2/h3H2,1-2H3,(H2,6,7,8,9);1-2H3 |
| InChIKey | SMOUGZAJVPTQCQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |