C5H8N4O2 — CID 104817287
N-(3-ethoxy-1H-1,2,4-triazol-5-yl)formamide (PubChem CID 104817287) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is N-(3-ethoxy-1H-1,2,4-triazol-5-yl)formamide.
| Compound Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)formamide |
|---|---|
| PubChem CID | 104817287 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | N-(3-ethoxy-1H-1,2,4-triazol-5-yl)formamide |
| SMILES | CCOc1n[nH]c(NC=O)n1 |
| InChI | InChI=1S/C5H8N4O2/c1-2-11-5-7-4(6-3-10)8-9-5/h3H,2H2,1H3,(H2,6,7,8,9,10) |
| InChIKey | RRLZTZNPLIDNPO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|