C6H10N4O3 — CID 83102540
ethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate (PubChem CID 83102540) has the molecular formula C6H10N4O3 and a molecular weight of 186.17 g/mol. Its IUPAC name is ethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate.
| Compound Name | ethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate |
|---|---|
| PubChem CID | 83102540 |
| Molecular Formula | C6H10N4O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | ethyl N-(3-methoxy-1H-1,2,4-triazol-5-yl)carbamate |
| SMILES | CCOC(=O)Nc1nc(OC)n[nH]1 |
| InChI | InChI=1S/C6H10N4O3/c1-3-13-6(11)8-4-7-5(12-2)10-9-4/h3H2,1-2H3,(H2,7,8,9,10,11) |
| InChIKey | PNTBRNPTLNDTEQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |