C6H12N4O — CID 112596254
5-ethoxy-N,4-dimethyl-1,2,4-triazol-3-amine (PubChem CID 112596254) has the molecular formula C6H12N4O and a molecular weight of 156.19 g/mol. Its IUPAC name is 5-ethoxy-N,4-dimethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-ethoxy-N,4-dimethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 112596254 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 5-ethoxy-N,4-dimethyl-1,2,4-triazol-3-amine |
| SMILES | CCOc1nnc(NC)n1C |
| InChI | InChI=1S/C6H12N4O/c1-4-11-6-9-8-5(7-2)10(6)3/h4H2,1-3H3,(H,7,8) |
| InChIKey | HIZJGIVDIOARKL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |