C5H10N4O — CID 65369127
1-(ethoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 65369127) has the molecular formula C5H10N4O and a molecular weight of 142.16 g/mol. Its IUPAC name is 1-(ethoxymethyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(ethoxymethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 65369127 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 1-(ethoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | CCOCn1cnc(N)n1 |
| InChI | InChI=1S/C5H10N4O/c1-2-10-4-9-3-7-5(6)8-9/h3H,2,4H2,1H3,(H2,6,8) |
| InChIKey | UELZVXOQZLCRGT-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |