C6H11N3O2 — CID 67757502
3-(2-methoxyethoxy)-1-methyl-1,2,4-triazole (PubChem CID 67757502) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is 3-(2-methoxyethoxy)-1-methyl-1,2,4-triazole.
| Compound Name | 3-(2-methoxyethoxy)-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 67757502 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 3-(2-methoxyethoxy)-1-methyl-1,2,4-triazole |
| SMILES | COCCOc1ncn(C)n1 |
| InChI | InChI=1S/C6H11N3O2/c1-9-5-7-6(8-9)11-4-3-10-2/h5H,3-4H2,1-2H3 |
| InChIKey | LIOKOVLWLQKNFE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|