C5H9N3O — CID 54201153
3-ethoxy-4-methyl-1,2,4-triazole (PubChem CID 54201153) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is 3-ethoxy-4-methyl-1,2,4-triazole.
| Compound Name | 3-ethoxy-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 54201153 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 3-ethoxy-4-methyl-1,2,4-triazole |
| SMILES | CCOc1nncn1C |
| InChI | InChI=1S/C5H9N3O/c1-3-9-5-7-6-4-8(5)2/h4H,3H2,1-2H3 |
| InChIKey | JHVUVQKBZADDFB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |