C5H10N4O — CID 166115218
5-ethoxy-4-methyl-1,2,4-triazol-3-amine (PubChem CID 166115218) has the molecular formula C5H10N4O and a molecular weight of 142.16 g/mol. Its IUPAC name is 5-ethoxy-4-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-ethoxy-4-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 166115218 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 5-ethoxy-4-methyl-1,2,4-triazol-3-amine |
| SMILES | CCOc1nnc(N)n1C |
| InChI | InChI=1S/C5H10N4O/c1-3-10-5-8-7-4(6)9(5)2/h3H2,1-2H3,(H2,6,7) |
| InChIKey | ANAUQUWKGWFRIR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |