C4H9N5O3S — CID 104818915
3-ethoxy-5-(sulfamoylamino)-1H-1,2,4-triazole (PubChem CID 104818915) has the molecular formula C4H9N5O3S and a molecular weight of 207.21 g/mol. Its IUPAC name is 3-ethoxy-5-(sulfamoylamino)-1H-1,2,4-triazole.
| Compound Name | 3-ethoxy-5-(sulfamoylamino)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 104818915 |
| Molecular Formula | C4H9N5O3S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 3-ethoxy-5-(sulfamoylamino)-1H-1,2,4-triazole |
| SMILES | CCOc1n[nH]c(NS(N)(=O)=O)n1 |
| InChI | InChI=1S/C4H9N5O3S/c1-2-12-4-6-3(7-8-4)9-13(5,10)11/h2H2,1H3,(H2,5,10,11)(H2,6,7,8,9) |
| InChIKey | FZCDSXYFJGGZQV-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |