C10H16N4O4S — CID 114461679
propan-2-yl N-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]carbamate (PubChem CID 114461679) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is propan-2-yl N-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461679 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | propan-2-yl N-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]carbamate |
| SMILES | Cc1cc(NS(=O)(=O)NC(=O)OC(C)C)ncc1N |
| InChI | InChI=1S/C10H16N4O4S/c1-6(2)18-10(15)14-19(16,17)13-9-4-7(3)8(11)5-12-9/h4-6H,11H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | DBZWGPZAGCWYPC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |