C10H15N3O4S — CID 54952595
methyl 3-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]propanoate (PubChem CID 54952595) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is methyl 3-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]propanoate.
| Compound Name | methyl 3-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]propanoate |
|---|---|
| PubChem CID | 54952595 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | methyl 3-[(5-amino-4-methyl-2-pyridinyl)sulfamoyl]propanoate |
| SMILES | COC(=O)CCS(=O)(=O)Nc1cc(C)c(N)cn1 |
| InChI | InChI=1S/C10H15N3O4S/c1-7-5-9(12-6-8(7)11)13-18(15,16)4-3-10(14)17-2/h5-6H,3-4,11H2,1-2H3,(H,12,13) |
| InChIKey | HUTBVXFBKPFFHU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |