About ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate
ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate (PubChem CID 91594924) has the molecular formula C11H15BrN2O3S
and a molecular weight of 335.22 g/mol. Its IUPAC name is ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate |
| PubChem CID | 91594924 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate |
| SMILES | CC=S(=O)(NC(=O)OCC)c1ccc(N)cc1Br |
| InChI | InChI=1S/C11H15BrN2O3S/c1-3-17-11(15)14-18(16,4-2)10-6-5-8(13)7-9(10)12/h4-7H,3,13H2,1-2H3,(H,14,15,16) |
| InChIKey | TVEYTUBZMCXMSD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate?
The IUPAC name of ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate (CID 91594924) is ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate.
What is the SMILES notation for ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate?
The canonical SMILES for ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate is CC=S(=O)(NC(=O)OCC)c1ccc(N)cc1Br.
What is the InChIKey of ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate?
The InChIKey is TVEYTUBZMCXMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2O3S/c1-3-17-11(15)14-18(16,4-2)10-6-5-8(13)7-9(10)12/h4-7H,3,13H2,1-2H3,(H,14,15,16).
What are the key properties of ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate?
ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate has a molecular weight of 335.22 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate is sourced from PubChem (CID 91594924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).