C11H15BrN2O3S — CID 91594924
ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate (PubChem CID 91594924) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate.
| Compound Name | ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate |
|---|---|
| PubChem CID | 91594924 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | ethyl N-[(4-amino-2-bromophenyl)-ethylidene-oxo-λ6-sulfanyl]carbamate |
| SMILES | CC=S(=O)(NC(=O)OCC)c1ccc(N)cc1Br |
| InChI | InChI=1S/C11H15BrN2O3S/c1-3-17-11(15)14-18(16,4-2)10-6-5-8(13)7-9(10)12/h4-7H,3,13H2,1-2H3,(H,14,15,16) |
| InChIKey | TVEYTUBZMCXMSD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|