C12H16N4O4S — CID 114464444
ethyl N-[2-(1H-benzimidazol-2-yl)ethylsulfamoyl]carbamate (PubChem CID 114464444) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is ethyl N-[2-(1H-benzimidazol-2-yl)ethylsulfamoyl]carbamate.
| Compound Name | ethyl N-[2-(1H-benzimidazol-2-yl)ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464444 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | ethyl N-[2-(1H-benzimidazol-2-yl)ethylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H16N4O4S/c1-2-20-12(17)16-21(18,19)13-8-7-11-14-9-5-3-4-6-10(9)15-11/h3-6,13H,2,7-8H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | LRPAMTPAVIZGIH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |