C13H17N3O4S — CID 78991615
ethyl 3-(1H-benzimidazol-2-ylmethylsulfamoyl)propanoate (PubChem CID 78991615) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is ethyl 3-(1H-benzimidazol-2-ylmethylsulfamoyl)propanoate.
| Compound Name | ethyl 3-(1H-benzimidazol-2-ylmethylsulfamoyl)propanoate |
|---|---|
| PubChem CID | 78991615 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | ethyl 3-(1H-benzimidazol-2-ylmethylsulfamoyl)propanoate |
| SMILES | CCOC(=O)CCS(=O)(=O)NCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H17N3O4S/c1-2-20-13(17)7-8-21(18,19)14-9-12-15-10-5-3-4-6-11(10)16-12/h3-6,14H,2,7-9H2,1H3,(H,15,16) |
| InChIKey | YAQJTMRMYIVCEG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |