C13H22N2O4S — CID 114815613
[2-ethoxy-5-(2-methylpropylsulfamoylamino)phenyl]methanol (PubChem CID 114815613) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is [2-ethoxy-5-(2-methylpropylsulfamoylamino)phenyl]methanol.
| Compound Name | [2-ethoxy-5-(2-methylpropylsulfamoylamino)phenyl]methanol |
|---|---|
| PubChem CID | 114815613 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [2-ethoxy-5-(2-methylpropylsulfamoylamino)phenyl]methanol |
| SMILES | CCOc1ccc(NS(=O)(=O)NCC(C)C)cc1CO |
| InChI | InChI=1S/C13H22N2O4S/c1-4-19-13-6-5-12(7-11(13)9-16)15-20(17,18)14-8-10(2)3/h5-7,10,14-16H,4,8-9H2,1-3H3 |
| InChIKey | JCRHLYHNSHUPLG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |