C16H18ClNO4S — CID 60520999
4-chloro-N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2-methylbenzenesulfonamide (PubChem CID 60520999) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is 4-chloro-N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 60520999 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 4-chloro-N-[4-ethoxy-3-(hydroxymethyl)phenyl]-2-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(NS(=O)(=O)c2ccc(Cl)cc2C)cc1CO |
| InChI | InChI=1S/C16H18ClNO4S/c1-3-22-15-6-5-14(9-12(15)10-19)18-23(20,21)16-7-4-13(17)8-11(16)2/h4-9,18-19H,3,10H2,1-2H3 |
| InChIKey | IXMKMARKDJTVPJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |