C10H13N3O4S2 — CID 114465852
methyl N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methylsulfamoyl]carbamate (PubChem CID 114465852) has the molecular formula C10H13N3O4S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is methyl N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methylsulfamoyl]carbamate.
| Compound Name | methyl N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114465852 |
| Molecular Formula | C10H13N3O4S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | methyl N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)NCc1sccc1C#CCN |
| InChI | InChI=1S/C10H13N3O4S2/c1-17-10(14)13-19(15,16)12-7-9-8(3-2-5-11)4-6-18-9/h4,6,12H,5,7,11H2,1H3,(H,13,14) |
| InChIKey | IUKIGWZAVOQNND-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|