C14H18N2O3S2 — CID 104521002
N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiane-2-carboxamide (PubChem CID 104521002) has the molecular formula C14H18N2O3S2 and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiane-2-carboxamide.
| Compound Name | N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiane-2-carboxamide |
|---|---|
| PubChem CID | 104521002 |
| Molecular Formula | C14H18N2O3S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-1,1-dioxothiane-2-carboxamide |
| SMILES | NCC#Cc1ccsc1CNC(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C14H18N2O3S2/c15-7-3-4-11-6-8-20-12(11)10-16-14(17)13-5-1-2-9-21(13,18)19/h6,8,13H,1-2,5,7,9-10,15H2,(H,16,17) |
| InChIKey | MNJXMJRJJSYJBS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|