C11H13BrO3S2 — CID 114969845
2-(3-bromothiophen-2-yl)-1-(1,1-dioxothian-2-yl)ethanone (PubChem CID 114969845) has the molecular formula C11H13BrO3S2 and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-(3-bromothiophen-2-yl)-1-(1,1-dioxothian-2-yl)ethanone.
| Compound Name | 2-(3-bromothiophen-2-yl)-1-(1,1-dioxothian-2-yl)ethanone |
|---|---|
| PubChem CID | 114969845 |
| Molecular Formula | C11H13BrO3S2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 335.95 |
| IUPAC Name | 2-(3-bromothiophen-2-yl)-1-(1,1-dioxothian-2-yl)ethanone |
| SMILES | O=C(Cc1sccc1Br)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C11H13BrO3S2/c12-8-4-5-16-10(8)7-9(13)11-3-1-2-6-17(11,14)15/h4-5,11H,1-3,6-7H2 |
| InChIKey | IUZUXHNAEPMGHW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |