C12H20O3S — CID 114969368
2-cyclopentyl-1-(1,1-dioxothian-2-yl)ethanone (PubChem CID 114969368) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-cyclopentyl-1-(1,1-dioxothian-2-yl)ethanone.
| Compound Name | 2-cyclopentyl-1-(1,1-dioxothian-2-yl)ethanone |
|---|---|
| PubChem CID | 114969368 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-cyclopentyl-1-(1,1-dioxothian-2-yl)ethanone |
| SMILES | O=C(CC1CCCC1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H20O3S/c13-11(9-10-5-1-2-6-10)12-7-3-4-8-16(12,14)15/h10,12H,1-9H2 |
| InChIKey | IDHOQCPRZPIXKO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |