C9H14N4O3S — CID 107063202
1-(1,1-dioxothian-2-yl)-2-(2-methyltetrazol-5-yl)ethanone (PubChem CID 107063202) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-2-(2-methyltetrazol-5-yl)ethanone.
| Compound Name | 1-(1,1-dioxothian-2-yl)-2-(2-methyltetrazol-5-yl)ethanone |
|---|---|
| PubChem CID | 107063202 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-2-(2-methyltetrazol-5-yl)ethanone |
| SMILES | Cn1nnc(CC(=O)C2CCCCS2(=O)=O)n1 |
| InChI | InChI=1S/C9H14N4O3S/c1-13-11-9(10-12-13)6-7(14)8-4-2-3-5-17(8,15)16/h8H,2-6H2,1H3 |
| InChIKey | JHLMHYDIZHXCRD-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |