C12H16N4O3 — CID 156598418
5,5-dimethyl-2-[2-(2-methyltetrazol-5-yl)acetyl]cyclohexane-1,3-dione (PubChem CID 156598418) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 5,5-dimethyl-2-[2-(2-methyltetrazol-5-yl)acetyl]cyclohexane-1,3-dione.
| Compound Name | 5,5-dimethyl-2-[2-(2-methyltetrazol-5-yl)acetyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 156598418 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5,5-dimethyl-2-[2-(2-methyltetrazol-5-yl)acetyl]cyclohexane-1,3-dione |
| SMILES | Cn1nnc(CC(=O)C2C(=O)CC(C)(C)CC2=O)n1 |
| InChI | InChI=1S/C12H16N4O3/c1-12(2)5-8(18)11(9(19)6-12)7(17)4-10-13-15-16(3)14-10/h11H,4-6H2,1-3H3 |
| InChIKey | MGEYQRQAUXBFOC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|