C9H13F3O3S — CID 114976613
1-(1,1-dioxothian-2-yl)-4,4,4-trifluorobutan-1-one (PubChem CID 114976613) has the molecular formula C9H13F3O3S and a molecular weight of 258.26 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(1,1-dioxothian-2-yl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 114976613 |
| Molecular Formula | C9H13F3O3S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C9H13F3O3S/c10-9(11,12)5-4-7(13)8-3-1-2-6-16(8,14)15/h8H,1-6H2 |
| InChIKey | AGZSJDRTBDJIAV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |