C12H16O3S2 — CID 114972231
1-(1,1-dioxothian-2-yl)-3-thiophen-3-ylpropan-1-one (PubChem CID 114972231) has the molecular formula C12H16O3S2 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(1,1-dioxothian-2-yl)-3-thiophen-3-ylpropan-1-one.
| Compound Name | 1-(1,1-dioxothian-2-yl)-3-thiophen-3-ylpropan-1-one |
|---|---|
| PubChem CID | 114972231 |
| Molecular Formula | C12H16O3S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-(1,1-dioxothian-2-yl)-3-thiophen-3-ylpropan-1-one |
| SMILES | O=C(CCc1ccsc1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C12H16O3S2/c13-11(5-4-10-6-7-16-9-10)12-3-1-2-8-17(12,14)15/h6-7,9,12H,1-5,8H2 |
| InChIKey | BWDOBWIWZQHFCX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |