C14H15NO3S2 — CID 104520090
2-(1,3-benzothiazol-2-yl)-1-(1,1-dioxothian-2-yl)ethanone (PubChem CID 104520090) has the molecular formula C14H15NO3S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-1-(1,1-dioxothian-2-yl)ethanone.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-1-(1,1-dioxothian-2-yl)ethanone |
|---|---|
| PubChem CID | 104520090 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-1-(1,1-dioxothian-2-yl)ethanone |
| SMILES | O=C(Cc1nc2ccccc2s1)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C14H15NO3S2/c16-11(13-7-3-4-8-20(13,17)18)9-14-15-10-5-1-2-6-12(10)19-14/h1-2,5-6,13H,3-4,7-9H2 |
| InChIKey | AHVDLDJALMWPQZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |